C15H23N3O4 — CID 95145817
(2R)-N-(furan-2-ylmethyl)-2-[2-[(2R)-oxolan-2-yl]ethylcarbamoylamino]propanamide (PubChem CID 95145817) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is (2R)-N-(furan-2-ylmethyl)-2-[2-[(2R)-oxolan-2-yl]ethylcarbamoylamino]propanamide.
| Compound Name | (2R)-N-(furan-2-ylmethyl)-2-[2-[(2R)-oxolan-2-yl]ethylcarbamoylamino]propanamide |
|---|---|
| PubChem CID | 95145817 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (2R)-N-(furan-2-ylmethyl)-2-[2-[(2R)-oxolan-2-yl]ethylcarbamoylamino]propanamide |
| SMILES | C[C@@H](NC(=O)NCC[C@H]1CCCO1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H23N3O4/c1-11(14(19)17-10-13-5-3-9-22-13)18-15(20)16-7-6-12-4-2-8-21-12/h3,5,9,11-12H,2,4,6-8,10H2,1H3,(H,17,19)(H2,16,18,20)/t11-,12-/m1/s1 |
| InChIKey | BBAIVWUJKVVDGR-VXGBXAGGSA-N |
| XLogP | 1.15 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |