C22H18FNO2S — CID 95146289
2-(2,3-dihydro-1H-inden-5-yl)-N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]-2-oxoacetamide (PubChem CID 95146289) has the molecular formula C22H18FNO2S and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yl)-N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]-2-oxoacetamide.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yl)-N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 95146289 |
| Molecular Formula | C22H18FNO2S |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yl)-N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]-2-oxoacetamide |
| SMILES | O=C(N[C@H](c1ccc(F)cc1)c1cccs1)C(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C22H18FNO2S/c23-18-10-8-15(9-11-18)20(19-5-2-12-27-19)24-22(26)21(25)17-7-6-14-3-1-4-16(14)13-17/h2,5-13,20H,1,3-4H2,(H,24,26)/t20-/m1/s1 |
| InChIKey | BZKYTZWUKJHDLQ-HXUWFJFHSA-N |
| XLogP | 4.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|