C18H24N2O3S — CID 95157907
5-(acetamidomethyl)-N-[(1R)-2-ethyl-1-thiophen-2-ylbutyl]furan-2-carboxamide (PubChem CID 95157907) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 5-(acetamidomethyl)-N-[(1R)-2-ethyl-1-thiophen-2-ylbutyl]furan-2-carboxamide.
| Compound Name | 5-(acetamidomethyl)-N-[(1R)-2-ethyl-1-thiophen-2-ylbutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 95157907 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 5-(acetamidomethyl)-N-[(1R)-2-ethyl-1-thiophen-2-ylbutyl]furan-2-carboxamide |
| SMILES | CCC(CC)[C@@H](NC(=O)c1ccc(CNC(C)=O)o1)c1cccs1 |
| InChI | InChI=1S/C18H24N2O3S/c1-4-13(5-2)17(16-7-6-10-24-16)20-18(22)15-9-8-14(23-15)11-19-12(3)21/h6-10,13,17H,4-5,11H2,1-3H3,(H,19,21)(H,20,22)/t17-/m1/s1 |
| InChIKey | BCJXYCHNJHNCMM-QGZVFWFLSA-N |
| XLogP | 3.88 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |