C17H15N3O2 — CID 95169945
3-methyl-5-oxo-N,2-diphenyl-1H-pyrazole-4-carboxamide (PubChem CID 95169945) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 3-methyl-5-oxo-N,2-diphenyl-1H-pyrazole-4-carboxamide.
| Compound Name | 3-methyl-5-oxo-N,2-diphenyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 95169945 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-methyl-5-oxo-N,2-diphenyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2)c(=O)[nH]n1-c1ccccc1 |
| InChI | InChI=1S/C17H15N3O2/c1-12-15(16(21)18-13-8-4-2-5-9-13)17(22)19-20(12)14-10-6-3-7-11-14/h2-11H,1H3,(H,18,21)(H,19,22) |
| InChIKey | UWWZFIGYYFSHAO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |