C20H21N4O4+ — CID 4874514
ethyl 3-[4-oxo-3-phenyl-5-(phenylcarbamoyl)-2H-triazol-1-ium-1-yl]propanoate (PubChem CID 4874514) has the molecular formula C20H21N4O4+ and a molecular weight of 381.41 g/mol. Its IUPAC name is ethyl 3-[4-oxo-3-phenyl-5-(phenylcarbamoyl)-2H-triazol-1-ium-1-yl]propanoate.
| Compound Name | ethyl 3-[4-oxo-3-phenyl-5-(phenylcarbamoyl)-2H-triazol-1-ium-1-yl]propanoate |
|---|---|
| PubChem CID | 4874514 |
| Molecular Formula | C20H21N4O4+ |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | ethyl 3-[4-oxo-3-phenyl-5-(phenylcarbamoyl)-2H-triazol-1-ium-1-yl]propanoate |
| SMILES | CCOC(=O)CC[n+]1[nH]n(-c2ccccc2)c(=O)c1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H20N4O4/c1-2-28-17(25)13-14-23-18(19(26)21-15-9-5-3-6-10-15)20(27)24(22-23)16-11-7-4-8-12-16/h3-12H,2,13-14H2,1H3,(H-,21,22,26,27)/p+1 |
| InChIKey | OYEIKACJDFVSFI-UHFFFAOYSA-O |
| XLogP | 1.66 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|