C13H17F3N2O4S — CID 95202519
(2S)-N-[2-(dimethylsulfamoyl)ethyl]-2-hydroxy-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 95202519) has the molecular formula C13H17F3N2O4S and a molecular weight of 354.35 g/mol. Its IUPAC name is (2S)-N-[2-(dimethylsulfamoyl)ethyl]-2-hydroxy-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | (2S)-N-[2-(dimethylsulfamoyl)ethyl]-2-hydroxy-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 95202519 |
| Molecular Formula | C13H17F3N2O4S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | (2S)-N-[2-(dimethylsulfamoyl)ethyl]-2-hydroxy-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)[C@@H](O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3N2O4S/c1-18(2)23(21,22)8-7-17-12(20)11(19)9-3-5-10(6-4-9)13(14,15)16/h3-6,11,19H,7-8H2,1-2H3,(H,17,20)/t11-/m0/s1 |
| InChIKey | MMXQBVPFXIVYSQ-NSHDSACASA-N |
| XLogP | 0.75 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |