C15H23N7 — CID 95210945
N-[(1R)-3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine (PubChem CID 95210945) has the molecular formula C15H23N7 and a molecular weight of 301.40 g/mol. Its IUPAC name is N-[(1R)-3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[(1R)-3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 95210945 |
| Molecular Formula | C15H23N7 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | N-[(1R)-3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CC(C)C[C@@H](Nc1ncnc2c1CCNC2)c1ncnn1C |
| InChI | InChI=1S/C15H23N7/c1-10(2)6-12(15-19-9-20-22(15)3)21-14-11-4-5-16-7-13(11)17-8-18-14/h8-10,12,16H,4-7H2,1-3H3,(H,17,18,21)/t12-/m1/s1 |
| InChIKey | UYYYXQFVXDWANH-GFCCVEGCSA-N |
| XLogP | 1.45 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |