C17H20ClN3O — CID 95227129
(2S)-N-[(3-chlorophenyl)methyl]-N-cyclopropyl-2-(2-methylimidazol-1-yl)propanamide (PubChem CID 95227129) has the molecular formula C17H20ClN3O and a molecular weight of 317.82 g/mol. Its IUPAC name is (2S)-N-[(3-chlorophenyl)methyl]-N-cyclopropyl-2-(2-methylimidazol-1-yl)propanamide.
| Compound Name | (2S)-N-[(3-chlorophenyl)methyl]-N-cyclopropyl-2-(2-methylimidazol-1-yl)propanamide |
|---|---|
| PubChem CID | 95227129 |
| Molecular Formula | C17H20ClN3O |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | (2S)-N-[(3-chlorophenyl)methyl]-N-cyclopropyl-2-(2-methylimidazol-1-yl)propanamide |
| SMILES | Cc1nccn1[C@@H](C)C(=O)N(Cc1cccc(Cl)c1)C1CC1 |
| InChI | InChI=1S/C17H20ClN3O/c1-12(20-9-8-19-13(20)2)17(22)21(16-6-7-16)11-14-4-3-5-15(18)10-14/h3-5,8-10,12,16H,6-7,11H2,1-2H3/t12-/m0/s1 |
| InChIKey | GMTZVFMNIIOCNE-LBPRGKRZSA-N |
| XLogP | 3.60 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |