C16H23N3O4 — CID 95231017
2-[[(3S)-3-hydroxy-1-[(3-methoxyphenyl)methyl]-2-oxopiperidin-3-yl]methylamino]acetamide (PubChem CID 95231017) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[[(3S)-3-hydroxy-1-[(3-methoxyphenyl)methyl]-2-oxopiperidin-3-yl]methylamino]acetamide.
| Compound Name | 2-[[(3S)-3-hydroxy-1-[(3-methoxyphenyl)methyl]-2-oxopiperidin-3-yl]methylamino]acetamide |
|---|---|
| PubChem CID | 95231017 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-[[(3S)-3-hydroxy-1-[(3-methoxyphenyl)methyl]-2-oxopiperidin-3-yl]methylamino]acetamide |
| SMILES | COc1cccc(CN2CCC[C@](O)(CNCC(N)=O)C2=O)c1 |
| InChI | InChI=1S/C16H23N3O4/c1-23-13-5-2-4-12(8-13)10-19-7-3-6-16(22,15(19)21)11-18-9-14(17)20/h2,4-5,8,18,22H,3,6-7,9-11H2,1H3,(H2,17,20)/t16-/m0/s1 |
| InChIKey | UPOVNYWRRRAYKI-INIZCTEOSA-N |
| XLogP | -0.38 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |