C20H28N4O3 — CID 95219563
(3S)-3-hydroxy-1-[(3-methoxyphenyl)methyl]-3-[[2-(3-methylpyrazol-1-yl)ethylamino]methyl]piperidin-2-one (PubChem CID 95219563) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is (3S)-3-hydroxy-1-[(3-methoxyphenyl)methyl]-3-[[2-(3-methylpyrazol-1-yl)ethylamino]methyl]piperidin-2-one.
| Compound Name | (3S)-3-hydroxy-1-[(3-methoxyphenyl)methyl]-3-[[2-(3-methylpyrazol-1-yl)ethylamino]methyl]piperidin-2-one |
|---|---|
| PubChem CID | 95219563 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (3S)-3-hydroxy-1-[(3-methoxyphenyl)methyl]-3-[[2-(3-methylpyrazol-1-yl)ethylamino]methyl]piperidin-2-one |
| SMILES | COc1cccc(CN2CCC[C@](O)(CNCCn3ccc(C)n3)C2=O)c1 |
| InChI | InChI=1S/C20H28N4O3/c1-16-7-11-24(22-16)12-9-21-15-20(26)8-4-10-23(19(20)25)14-17-5-3-6-18(13-17)27-2/h3,5-7,11,13,21,26H,4,8-10,12,14-15H2,1-2H3/t20-/m0/s1 |
| InChIKey | NCAHWKCXVOAGFA-FQEVSTJZSA-N |
| XLogP | 1.34 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|