C20H31N3O4 — CID 95217840
(3R)-3-hydroxy-1-[(3-methoxyphenyl)methyl]-3-[(2-morpholin-4-ylethylamino)methyl]piperidin-2-one (PubChem CID 95217840) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-[(3-methoxyphenyl)methyl]-3-[(2-morpholin-4-ylethylamino)methyl]piperidin-2-one.
| Compound Name | (3R)-3-hydroxy-1-[(3-methoxyphenyl)methyl]-3-[(2-morpholin-4-ylethylamino)methyl]piperidin-2-one |
|---|---|
| PubChem CID | 95217840 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | (3R)-3-hydroxy-1-[(3-methoxyphenyl)methyl]-3-[(2-morpholin-4-ylethylamino)methyl]piperidin-2-one |
| SMILES | COc1cccc(CN2CCC[C@@](O)(CNCCN3CCOCC3)C2=O)c1 |
| InChI | InChI=1S/C20H31N3O4/c1-26-18-5-2-4-17(14-18)15-23-8-3-6-20(25,19(23)24)16-21-7-9-22-10-12-27-13-11-22/h2,4-5,14,21,25H,3,6-13,15-16H2,1H3/t20-/m1/s1 |
| InChIKey | LAVXKPDIBDOUJO-HXUWFJFHSA-N |
| XLogP | 0.47 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|