C14H15FN2O2S — CID 95278246
methyl (2S)-2-amino-3-(6-fluoro-2-methylquinolin-4-yl)sulfanylpropanoate (PubChem CID 95278246) has the molecular formula C14H15FN2O2S and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(6-fluoro-2-methylquinolin-4-yl)sulfanylpropanoate.
| Compound Name | methyl (2S)-2-amino-3-(6-fluoro-2-methylquinolin-4-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 95278246 |
| Molecular Formula | C14H15FN2O2S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | methyl (2S)-2-amino-3-(6-fluoro-2-methylquinolin-4-yl)sulfanylpropanoate |
| SMILES | COC(=O)[C@H](N)CSc1cc(C)nc2ccc(F)cc12 |
| InChI | InChI=1S/C14H15FN2O2S/c1-8-5-13(20-7-11(16)14(18)19-2)10-6-9(15)3-4-12(10)17-8/h3-6,11H,7,16H2,1-2H3/t11-/m1/s1 |
| InChIKey | IOBQZQOOWMWOHJ-LLVKDONJSA-N |
| XLogP | 2.27 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |