C15H15ClN2O4 — CID 95294228
(2S)-5-chloro-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 95294228) has the molecular formula C15H15ClN2O4 and a molecular weight of 322.75 g/mol. Its IUPAC name is (2S)-5-chloro-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (2S)-5-chloro-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 95294228 |
| Molecular Formula | C15H15ClN2O4 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | (2S)-5-chloro-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | CCN(C(=O)[C@@H]1Cc2cc(Cl)ccc2O1)[C@H]1CC(=O)NC1=O |
| InChI | InChI=1S/C15H15ClN2O4/c1-2-18(10-7-13(19)17-14(10)20)15(21)12-6-8-5-9(16)3-4-11(8)22-12/h3-5,10,12H,2,6-7H2,1H3,(H,17,19,20)/t10-,12-/m0/s1 |
| InChIKey | IDRALNGVRUKRPR-JQWIXIFHSA-N |
| XLogP | 0.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|