About [(1R)-1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl] furan-2-carboxylate
[(1R)-1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl] furan-2-carboxylate (PubChem CID 95310017) has the molecular formula C13H10BrN3O3
and a molecular weight of 336.15 g/mol. Its IUPAC name is [(1R)-1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl] furan-2-carboxylate.
Molecular Properties
| Compound Name | [(1R)-1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl] furan-2-carboxylate |
| PubChem CID | 95310017 |
| Molecular Formula | C13H10BrN3O3 |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | [(1R)-1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl] furan-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1ccco1)c1nc2ncc(Br)cc2[nH]1 |
| InChI | InChI=1S/C13H10BrN3O3/c1-7(20-13(18)10-3-2-4-19-10)11-16-9-5-8(14)6-15-12(9)17-11/h2-7H,1H3,(H,15,16,17)/t7-/m1/s1 |
| InChIKey | RFRKAPJQMKULIK-SSDOTTSWSA-N |
| XLogP | 3.23 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1R)-1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl] furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl] furan-2-carboxylate?
The IUPAC name of [(1R)-1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl] furan-2-carboxylate (CID 95310017) is [(1R)-1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl] furan-2-carboxylate.
What is the SMILES notation for [(1R)-1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl] furan-2-carboxylate?
The canonical SMILES for [(1R)-1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl] furan-2-carboxylate is C[C@@H](OC(=O)c1ccco1)c1nc2ncc(Br)cc2[nH]1.
What is the InChIKey of [(1R)-1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl] furan-2-carboxylate?
The InChIKey is RFRKAPJQMKULIK-SSDOTTSWSA-N. The full InChI is InChI=1S/C13H10BrN3O3/c1-7(20-13(18)10-3-2-4-19-10)11-16-9-5-8(14)6-15-12(9)17-11/h2-7H,1H3,(H,15,16,17)/t7-/m1/s1.
What are the key properties of [(1R)-1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl] furan-2-carboxylate?
[(1R)-1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl] furan-2-carboxylate has a molecular weight of 336.15 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl] furan-2-carboxylate is sourced from PubChem (CID 95310017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).