C17H22N4OS — CID 95310118
N-[(1S,2R)-2-benzylcyclohexyl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide (PubChem CID 95310118) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is N-[(1S,2R)-2-benzylcyclohexyl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide.
| Compound Name | N-[(1S,2R)-2-benzylcyclohexyl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 95310118 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-[(1S,2R)-2-benzylcyclohexyl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1ncn[nH]1)N[C@H]1CCCC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C17H22N4OS/c22-16(11-23-17-18-12-19-21-17)20-15-9-5-4-8-14(15)10-13-6-2-1-3-7-13/h1-3,6-7,12,14-15H,4-5,8-11H2,(H,20,22)(H,18,19,21)/t14-,15+/m1/s1 |
| InChIKey | NBXGTOLIGFCAPV-CABCVRRESA-N |
| XLogP | 2.81 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |