C20H28N4O — CID 95312612
N-[(2R)-2-(4-ethylpiperazin-1-yl)propyl]-2-methylquinoline-4-carboxamide (PubChem CID 95312612) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is N-[(2R)-2-(4-ethylpiperazin-1-yl)propyl]-2-methylquinoline-4-carboxamide.
| Compound Name | N-[(2R)-2-(4-ethylpiperazin-1-yl)propyl]-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 95312612 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | N-[(2R)-2-(4-ethylpiperazin-1-yl)propyl]-2-methylquinoline-4-carboxamide |
| SMILES | CCN1CCN([C@H](C)CNC(=O)c2cc(C)nc3ccccc23)CC1 |
| InChI | InChI=1S/C20H28N4O/c1-4-23-9-11-24(12-10-23)16(3)14-21-20(25)18-13-15(2)22-19-8-6-5-7-17(18)19/h5-8,13,16H,4,9-12,14H2,1-3H3,(H,21,25)/t16-/m1/s1 |
| InChIKey | MEHPHWAAZVPQCL-MRXNPFEDSA-N |
| XLogP | 2.30 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |