C17H24N2O5 — CID 95317119
methyl 3-[[2-[[(2S)-1-methoxy-2-methyl-1-oxopentan-2-yl]amino]acetyl]amino]benzoate (PubChem CID 95317119) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is methyl 3-[[2-[[(2S)-1-methoxy-2-methyl-1-oxopentan-2-yl]amino]acetyl]amino]benzoate.
| Compound Name | methyl 3-[[2-[[(2S)-1-methoxy-2-methyl-1-oxopentan-2-yl]amino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 95317119 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | methyl 3-[[2-[[(2S)-1-methoxy-2-methyl-1-oxopentan-2-yl]amino]acetyl]amino]benzoate |
| SMILES | CCC[C@](C)(NCC(=O)Nc1cccc(C(=O)OC)c1)C(=O)OC |
| InChI | InChI=1S/C17H24N2O5/c1-5-9-17(2,16(22)24-4)18-11-14(20)19-13-8-6-7-12(10-13)15(21)23-3/h6-8,10,18H,5,9,11H2,1-4H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | YQFRKNLGHMSSOT-KRWDZBQOSA-N |
| XLogP | 1.73 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |