C15H20N4O3S — CID 95317793
N'-[(1R)-1-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-N-(5-methyl-1,2-oxazol-3-yl)oxamide (PubChem CID 95317793) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is N'-[(1R)-1-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-N-(5-methyl-1,2-oxazol-3-yl)oxamide.
| Compound Name | N'-[(1R)-1-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-N-(5-methyl-1,2-oxazol-3-yl)oxamide |
|---|---|
| PubChem CID | 95317793 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N'-[(1R)-1-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-N-(5-methyl-1,2-oxazol-3-yl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)N[C@H](C)c2nc(C(C)(C)C)cs2)no1 |
| InChI | InChI=1S/C15H20N4O3S/c1-8-6-11(19-22-8)18-13(21)12(20)16-9(2)14-17-10(7-23-14)15(3,4)5/h6-7,9H,1-5H3,(H,16,20)(H,18,19,21)/t9-/m1/s1 |
| InChIKey | LPBBEGLYUXNZEB-SECBINFHSA-N |
| XLogP | 2.55 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|