C15H20N4O3S — CID 95319786
(6R)-N-[2-(3-methoxyphenyl)sulfonylethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95319786) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is (6R)-N-[2-(3-methoxyphenyl)sulfonylethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6R)-N-[2-(3-methoxyphenyl)sulfonylethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95319786 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (6R)-N-[2-(3-methoxyphenyl)sulfonylethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | COc1cccc(S(=O)(=O)CCN[C@@H]2CCc3ncnn3C2)c1 |
| InChI | InChI=1S/C15H20N4O3S/c1-22-13-3-2-4-14(9-13)23(20,21)8-7-16-12-5-6-15-17-11-18-19(15)10-12/h2-4,9,11-12,16H,5-8,10H2,1H3/t12-/m1/s1 |
| InChIKey | OBNKDQODUADRGO-GFCCVEGCSA-N |
| XLogP | 0.67 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |