C16H19N7 — CID 95323257
(6S)-N-[(1-methyl-3-pyridin-4-ylpyrazol-4-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95323257) has the molecular formula C16H19N7 and a molecular weight of 309.38 g/mol. Its IUPAC name is (6S)-N-[(1-methyl-3-pyridin-4-ylpyrazol-4-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6S)-N-[(1-methyl-3-pyridin-4-ylpyrazol-4-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95323257 |
| Molecular Formula | C16H19N7 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (6S)-N-[(1-methyl-3-pyridin-4-ylpyrazol-4-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | Cn1cc(CN[C@H]2CCc3ncnn3C2)c(-c2ccncc2)n1 |
| InChI | InChI=1S/C16H19N7/c1-22-9-13(16(21-22)12-4-6-17-7-5-12)8-18-14-2-3-15-19-11-20-23(15)10-14/h4-7,9,11,14,18H,2-3,8,10H2,1H3/t14-/m0/s1 |
| InChIKey | NVEJQTBZFDSGHD-AWEZNQCLSA-N |
| XLogP | 1.18 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |