C18H22N2O5 — CID 95352052
methyl (3R)-3-[(7-methoxy-1-benzofuran-2-yl)methylcarbamoyl]piperidine-1-carboxylate (PubChem CID 95352052) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is methyl (3R)-3-[(7-methoxy-1-benzofuran-2-yl)methylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | methyl (3R)-3-[(7-methoxy-1-benzofuran-2-yl)methylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 95352052 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | methyl (3R)-3-[(7-methoxy-1-benzofuran-2-yl)methylcarbamoyl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC[C@@H](C(=O)NCc2cc3cccc(OC)c3o2)C1 |
| InChI | InChI=1S/C18H22N2O5/c1-23-15-7-3-5-12-9-14(25-16(12)15)10-19-17(21)13-6-4-8-20(11-13)18(22)24-2/h3,5,7,9,13H,4,6,8,10-11H2,1-2H3,(H,19,21)/t13-/m1/s1 |
| InChIKey | UOJQNUIRXPGRLD-CYBMUJFWSA-N |
| XLogP | 2.54 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |