C7H12F3N — CID 95366768
(2R,6R)-2-methyl-6-(trifluoromethyl)piperidine (PubChem CID 95366768) has the molecular formula C7H12F3N and a molecular weight of 167.17 g/mol. Its IUPAC name is (2R,6R)-2-methyl-6-(trifluoromethyl)piperidine.
| Compound Name | (2R,6R)-2-methyl-6-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 95366768 |
| Molecular Formula | C7H12F3N |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | (2R,6R)-2-methyl-6-(trifluoromethyl)piperidine |
| SMILES | C[C@@H]1CCC[C@H](C(F)(F)F)N1 |
| InChI | InChI=1S/C7H12F3N/c1-5-3-2-4-6(11-5)7(8,9)10/h5-6,11H,2-4H2,1H3/t5-,6-/m1/s1 |
| InChIKey | ZAKCFTLJCCJOLA-PHDIDXHHSA-N |
| XLogP | 2.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |