C14H19N3O3S — CID 95382709
2-[benzenesulfonyl(methyl)amino]-N-[(2S)-2-cyanobutan-2-yl]acetamide (PubChem CID 95382709) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-[benzenesulfonyl(methyl)amino]-N-[(2S)-2-cyanobutan-2-yl]acetamide.
| Compound Name | 2-[benzenesulfonyl(methyl)amino]-N-[(2S)-2-cyanobutan-2-yl]acetamide |
|---|---|
| PubChem CID | 95382709 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[benzenesulfonyl(methyl)amino]-N-[(2S)-2-cyanobutan-2-yl]acetamide |
| SMILES | CC[C@@](C)(C#N)NC(=O)CN(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H19N3O3S/c1-4-14(2,11-15)16-13(18)10-17(3)21(19,20)12-8-6-5-7-9-12/h5-9H,4,10H2,1-3H3,(H,16,18)/t14-/m0/s1 |
| InChIKey | VLVHQROSGBUHGM-AWEZNQCLSA-N |
| XLogP | 1.12 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |