C11H10ClNOS2 — CID 95474697
4-(5-chloro-2-methoxy-4-methylphenyl)-3H-1,3-thiazole-2-thione (PubChem CID 95474697) has the molecular formula C11H10ClNOS2 and a molecular weight of 271.79 g/mol. Its IUPAC name is 4-(5-chloro-2-methoxy-4-methylphenyl)-3H-1,3-thiazole-2-thione.
| Compound Name | 4-(5-chloro-2-methoxy-4-methylphenyl)-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 95474697 |
| Molecular Formula | C11H10ClNOS2 |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 4-(5-chloro-2-methoxy-4-methylphenyl)-3H-1,3-thiazole-2-thione |
| SMILES | COc1cc(C)c(Cl)cc1-c1csc(=S)[nH]1 |
| InChI | InChI=1S/C11H10ClNOS2/c1-6-3-10(14-2)7(4-8(6)12)9-5-16-11(15)13-9/h3-5H,1-2H3,(H,13,15) |
| InChIKey | VNJSHGXHBSUDTG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|