C14H19ClN4S — CID 95507054
N-(12-chloro-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-10-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 95507054) has the molecular formula C14H19ClN4S and a molecular weight of 310.85 g/mol. Its IUPAC name is N-(12-chloro-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-10-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(12-chloro-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-10-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 95507054 |
| Molecular Formula | C14H19ClN4S |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-(12-chloro-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-10-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(Cl)c2c3c(sc2n1)CCC3 |
| InChI | InChI=1S/C14H19ClN4S/c1-19(2)8-4-7-16-14-17-12(15)11-9-5-3-6-10(9)20-13(11)18-14/h3-8H2,1-2H3,(H,16,17,18) |
| InChIKey | HRLTVHMYYUVJPR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|