C19H29N7O2 — CID 95552824
(3S)-N-(2-methoxyethyl)-1-[1-(7H-purin-6-yl)piperidin-4-yl]piperidine-3-carboxamide (PubChem CID 95552824) has the molecular formula C19H29N7O2 and a molecular weight of 387.49 g/mol. Its IUPAC name is (3S)-N-(2-methoxyethyl)-1-[1-(7H-purin-6-yl)piperidin-4-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-(2-methoxyethyl)-1-[1-(7H-purin-6-yl)piperidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95552824 |
| Molecular Formula | C19H29N7O2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | (3S)-N-(2-methoxyethyl)-1-[1-(7H-purin-6-yl)piperidin-4-yl]piperidine-3-carboxamide |
| SMILES | COCCNC(=O)[C@H]1CCCN(C2CCN(c3ncnc4nc[nH]c34)CC2)C1 |
| InChI | InChI=1S/C19H29N7O2/c1-28-10-6-20-19(27)14-3-2-7-26(11-14)15-4-8-25(9-5-15)18-16-17(22-12-21-16)23-13-24-18/h12-15H,2-11H2,1H3,(H,20,27)(H,21,22,23,24)/t14-/m0/s1 |
| InChIKey | OBCLEKHFLRQQEA-AWEZNQCLSA-N |
| XLogP | 0.80 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|