C12H8F2N2O2 — CID 95559227
3-but-2-ynyl-5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-one (PubChem CID 95559227) has the molecular formula C12H8F2N2O2 and a molecular weight of 250.20 g/mol. Its IUPAC name is 3-but-2-ynyl-5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-one.
| Compound Name | 3-but-2-ynyl-5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 95559227 |
| Molecular Formula | C12H8F2N2O2 |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 3-but-2-ynyl-5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-one |
| SMILES | CC#CCn1nc(-c2ccc(F)cc2F)oc1=O |
| InChI | InChI=1S/C12H8F2N2O2/c1-2-3-6-16-12(17)18-11(15-16)9-5-4-8(13)7-10(9)14/h4-5,7H,6H2,1H3 |
| InChIKey | YSFJFKRAUQRKEX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|