C13H16 — CID 95564926
(1S,6S)-2-methyltricyclo[4.4.2.01,6]dodeca-2,4,11-triene (PubChem CID 95564926) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is (1S,6S)-2-methyltricyclo[4.4.2.01,6]dodeca-2,4,11-triene.
| Compound Name | (1S,6S)-2-methyltricyclo[4.4.2.01,6]dodeca-2,4,11-triene |
|---|---|
| PubChem CID | 95564926 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | (1S,6S)-2-methyltricyclo[4.4.2.01,6]dodeca-2,4,11-triene |
| SMILES | CC1=CC=C[C@@]23C=C[C@@]12CCCC3 |
| InChI | InChI=1S/C13H16/c1-11-5-4-7-12-6-2-3-8-13(11,12)10-9-12/h4-5,7,9-10H,2-3,6,8H2,1H3/t12-,13-/m0/s1 |
| InChIKey | PUWVMJMRPWLAGZ-STQMWFEESA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|