C13H15BrO — CID 98162631
(1R,6R,11S)-12-bromotricyclo[4.4.3.01,6]trideca-2,4,12-trien-11-ol (PubChem CID 98162631) has the molecular formula C13H15BrO and a molecular weight of 267.17 g/mol. Its IUPAC name is (1R,6R,11S)-12-bromotricyclo[4.4.3.01,6]trideca-2,4,12-trien-11-ol.
| Compound Name | (1R,6R,11S)-12-bromotricyclo[4.4.3.01,6]trideca-2,4,12-trien-11-ol |
|---|---|
| PubChem CID | 98162631 |
| Molecular Formula | C13H15BrO |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | (1R,6R,11S)-12-bromotricyclo[4.4.3.01,6]trideca-2,4,12-trien-11-ol |
| SMILES | O[C@@H]1C(Br)=C[C@@]23C=CC=C[C@@]12CCCC3 |
| InChI | InChI=1S/C13H15BrO/c14-10-9-12-5-1-3-7-13(12,11(10)15)8-4-2-6-12/h1,3,5,7,9,11,15H,2,4,6,8H2/t11-,12+,13-/m1/s1 |
| InChIKey | ITCLKBWWVBDKIL-FRRDWIJNSA-N |
| XLogP | 3.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |