C24H26N2O5 — CID 95601721
[(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] (3R)-1-oxo-3,4-dihydroisochromene-3-carboxylate (PubChem CID 95601721) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] (3R)-1-oxo-3,4-dihydroisochromene-3-carboxylate.
| Compound Name | [(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] (3R)-1-oxo-3,4-dihydroisochromene-3-carboxylate |
|---|---|
| PubChem CID | 95601721 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] (3R)-1-oxo-3,4-dihydroisochromene-3-carboxylate |
| SMILES | C[C@@H](OC(=O)[C@H]1Cc2ccccc2C(=O)O1)C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H26N2O5/c1-16(30-24(29)21-15-17-7-3-4-8-20(17)23(28)31-21)22(27)25-18-9-11-19(12-10-18)26-13-5-2-6-14-26/h3-4,7-12,16,21H,2,5-6,13-15H2,1H3,(H,25,27)/t16-,21-/m1/s1 |
| InChIKey | ZPJOJZQKKIXLRD-IIBYNOLFSA-N |
| XLogP | 3.33 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|