C17H19NO3S — CID 95611425
[(1R)-cyclohex-3-en-1-yl]methyl 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetate (PubChem CID 95611425) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is [(1R)-cyclohex-3-en-1-yl]methyl 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetate.
| Compound Name | [(1R)-cyclohex-3-en-1-yl]methyl 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 95611425 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | [(1R)-cyclohex-3-en-1-yl]methyl 2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetate |
| SMILES | Cc1ccc(-c2nc(CC(=O)OC[C@H]3CC=CCC3)cs2)o1 |
| InChI | InChI=1S/C17H19NO3S/c1-12-7-8-15(21-12)17-18-14(11-22-17)9-16(19)20-10-13-5-3-2-4-6-13/h2-3,7-8,11,13H,4-6,9-10H2,1H3/t13-/m0/s1 |
| InChIKey | BXVMKOVAZKUQFE-ZDUSSCGKSA-N |
| XLogP | 4.15 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|