C10H19N3O2S — CID 95613999
(2S,3R)-N-(2-methylsulfonylethyl)-3-pyrazol-1-ylbutan-2-amine (PubChem CID 95613999) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is (2S,3R)-N-(2-methylsulfonylethyl)-3-pyrazol-1-ylbutan-2-amine.
| Compound Name | (2S,3R)-N-(2-methylsulfonylethyl)-3-pyrazol-1-ylbutan-2-amine |
|---|---|
| PubChem CID | 95613999 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (2S,3R)-N-(2-methylsulfonylethyl)-3-pyrazol-1-ylbutan-2-amine |
| SMILES | C[C@H](NCCS(C)(=O)=O)[C@@H](C)n1cccn1 |
| InChI | InChI=1S/C10H19N3O2S/c1-9(11-6-8-16(3,14)15)10(2)13-7-4-5-12-13/h4-5,7,9-11H,6,8H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | FVFHDVTUYJIWML-VHSXEESVSA-N |
| XLogP | 0.47 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |