About (1S)-N'-[2-(difluoromethylsulfonyl)phenyl]-1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine
(1S)-N'-[2-(difluoromethylsulfonyl)phenyl]-1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine (PubChem CID 95620062) has the molecular formula C15H18F2N2O3S
and a molecular weight of 344.38 g/mol. Its IUPAC name is (1S)-N'-[2-(difluoromethylsulfonyl)phenyl]-1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | (1S)-N'-[2-(difluoromethylsulfonyl)phenyl]-1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine |
| PubChem CID | 95620062 |
| Molecular Formula | C15H18F2N2O3S |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (1S)-N'-[2-(difluoromethylsulfonyl)phenyl]-1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine |
| SMILES | CN(C)[C@@H](CNc1ccccc1S(=O)(=O)C(F)F)c1ccco1 |
| InChI | InChI=1S/C15H18F2N2O3S/c1-19(2)12(13-7-5-9-22-13)10-18-11-6-3-4-8-14(11)23(20,21)15(16)17/h3-9,12,15,18H,10H2,1-2H3/t12-/m0/s1 |
| InChIKey | OZHZHLJNPWMHDD-LBPRGKRZSA-N |
| XLogP | 2.99 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1S)-N'-[2-(difluoromethylsulfonyl)phenyl]-1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N'-[2-(difluoromethylsulfonyl)phenyl]-1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine?
The IUPAC name of (1S)-N'-[2-(difluoromethylsulfonyl)phenyl]-1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine (CID 95620062) is (1S)-N'-[2-(difluoromethylsulfonyl)phenyl]-1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine.
What is the SMILES notation for (1S)-N'-[2-(difluoromethylsulfonyl)phenyl]-1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine?
The canonical SMILES for (1S)-N'-[2-(difluoromethylsulfonyl)phenyl]-1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine is CN(C)[C@@H](CNc1ccccc1S(=O)(=O)C(F)F)c1ccco1.
What is the InChIKey of (1S)-N'-[2-(difluoromethylsulfonyl)phenyl]-1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine?
The InChIKey is OZHZHLJNPWMHDD-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H18F2N2O3S/c1-19(2)12(13-7-5-9-22-13)10-18-11-6-3-4-8-14(11)23(20,21)15(16)17/h3-9,12,15,18H,10H2,1-2H3/t12-/m0/s1.
What are the key properties of (1S)-N'-[2-(difluoromethylsulfonyl)phenyl]-1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine?
(1S)-N'-[2-(difluoromethylsulfonyl)phenyl]-1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine has a molecular weight of 344.38 g/mol, XLogP of 2.99, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N'-[2-(difluoromethylsulfonyl)phenyl]-1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine is sourced from PubChem (CID 95620062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).