C14H16FN3O — CID 95622939
cis-(1R,2S)-2-[(5-fluoroquinazolin-4-yl)amino]cyclohexan-1-ol (PubChem CID 95622939) has the molecular formula C14H16FN3O and a molecular weight of 261.30 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(5-fluoroquinazolin-4-yl)amino]cyclohexan-1-ol.
| Compound Name | cis-(1R,2S)-2-[(5-fluoroquinazolin-4-yl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 95622939 |
| Molecular Formula | C14H16FN3O |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | cis-(1R,2S)-2-[(5-fluoroquinazolin-4-yl)amino]cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@@H]1Nc1ncnc2cccc(F)c12 |
| InChI | InChI=1S/C14H16FN3O/c15-9-4-3-6-11-13(9)14(17-8-16-11)18-10-5-1-2-7-12(10)19/h3-4,6,8,10,12,19H,1-2,5,7H2,(H,16,17,18)/t10-,12+/m0/s1 |
| InChIKey | XEHCPVQWEOQOEQ-CMPLNLGQSA-N |
| XLogP | 2.48 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |