C18H18N2O3S — CID 95625825
N-(3-cyano-5-phenylthiophen-2-yl)-2-[[(2R)-oxolan-2-yl]methoxy]acetamide (PubChem CID 95625825) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-(3-cyano-5-phenylthiophen-2-yl)-2-[[(2R)-oxolan-2-yl]methoxy]acetamide.
| Compound Name | N-(3-cyano-5-phenylthiophen-2-yl)-2-[[(2R)-oxolan-2-yl]methoxy]acetamide |
|---|---|
| PubChem CID | 95625825 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-(3-cyano-5-phenylthiophen-2-yl)-2-[[(2R)-oxolan-2-yl]methoxy]acetamide |
| SMILES | N#Cc1cc(-c2ccccc2)sc1NC(=O)COC[C@H]1CCCO1 |
| InChI | InChI=1S/C18H18N2O3S/c19-10-14-9-16(13-5-2-1-3-6-13)24-18(14)20-17(21)12-22-11-15-7-4-8-23-15/h1-3,5-6,9,15H,4,7-8,11-12H2,(H,20,21)/t15-/m1/s1 |
| InChIKey | CXZKUKRKRQAOPI-OAHLLOKOSA-N |
| XLogP | 3.42 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |