C15H17F2N3O2 — CID 95635039
N-[(3R)-1-cyclopropylpyrrolidin-3-yl]-N'-(2,3-difluorophenyl)oxamide (PubChem CID 95635039) has the molecular formula C15H17F2N3O2 and a molecular weight of 309.32 g/mol. Its IUPAC name is N-[(3R)-1-cyclopropylpyrrolidin-3-yl]-N'-(2,3-difluorophenyl)oxamide.
| Compound Name | N-[(3R)-1-cyclopropylpyrrolidin-3-yl]-N'-(2,3-difluorophenyl)oxamide |
|---|---|
| PubChem CID | 95635039 |
| Molecular Formula | C15H17F2N3O2 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[(3R)-1-cyclopropylpyrrolidin-3-yl]-N'-(2,3-difluorophenyl)oxamide |
| SMILES | O=C(Nc1cccc(F)c1F)C(=O)N[C@@H]1CCN(C2CC2)C1 |
| InChI | InChI=1S/C15H17F2N3O2/c16-11-2-1-3-12(13(11)17)19-15(22)14(21)18-9-6-7-20(8-9)10-4-5-10/h1-3,9-10H,4-8H2,(H,18,21)(H,19,22)/t9-/m1/s1 |
| InChIKey | CUFKFPWVLRTUEZ-SECBINFHSA-N |
| XLogP | 1.26 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|