C15H16FN3O3 — CID 95688442
1-(2-fluorophenyl)-N-[(2S)-oxan-2-yl]oxypyrazole-3-carboxamide (PubChem CID 95688442) has the molecular formula C15H16FN3O3 and a molecular weight of 305.31 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[(2S)-oxan-2-yl]oxypyrazole-3-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-[(2S)-oxan-2-yl]oxypyrazole-3-carboxamide |
|---|---|
| PubChem CID | 95688442 |
| Molecular Formula | C15H16FN3O3 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[(2S)-oxan-2-yl]oxypyrazole-3-carboxamide |
| SMILES | O=C(NO[C@H]1CCCCO1)c1ccn(-c2ccccc2F)n1 |
| InChI | InChI=1S/C15H16FN3O3/c16-11-5-1-2-6-13(11)19-9-8-12(17-19)15(20)18-22-14-7-3-4-10-21-14/h1-2,5-6,8-9,14H,3-4,7,10H2,(H,18,20)/t14-/m0/s1 |
| InChIKey | AWECXMAYPYKXJS-AWEZNQCLSA-N |
| XLogP | 2.20 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|