C20H23N3OS — CID 95749522
N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]-1-ethyl-2,3-dimethylindole-5-carboxamide (PubChem CID 95749522) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]-1-ethyl-2,3-dimethylindole-5-carboxamide.
| Compound Name | N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]-1-ethyl-2,3-dimethylindole-5-carboxamide |
|---|---|
| PubChem CID | 95749522 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]-1-ethyl-2,3-dimethylindole-5-carboxamide |
| SMILES | CCn1c(C)c(C)c2cc(C(=O)NCc3csc(C4CC4)n3)ccc21 |
| InChI | InChI=1S/C20H23N3OS/c1-4-23-13(3)12(2)17-9-15(7-8-18(17)23)19(24)21-10-16-11-25-20(22-16)14-5-6-14/h7-9,11,14H,4-6,10H2,1-3H3,(H,21,24) |
| InChIKey | ZVHXMLNEZMWZBC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|