C10H17NO — CID 95757202
(5S)-5,6,6-trimethyl-3-oxoheptanenitrile (PubChem CID 95757202) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (5S)-5,6,6-trimethyl-3-oxoheptanenitrile.
| Compound Name | (5S)-5,6,6-trimethyl-3-oxoheptanenitrile |
|---|---|
| PubChem CID | 95757202 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (5S)-5,6,6-trimethyl-3-oxoheptanenitrile |
| SMILES | C[C@@H](CC(=O)CC#N)C(C)(C)C |
| InChI | InChI=1S/C10H17NO/c1-8(10(2,3)4)7-9(12)5-6-11/h8H,5,7H2,1-4H3/t8-/m0/s1 |
| InChIKey | OKOQZWYYNUEFST-QMMMGPOBSA-N |
| XLogP | 2.54 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |