C17H23FN4O2 — CID 95759523
N-[2-(4-fluorophenoxy)ethyl]-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide (PubChem CID 95759523) has the molecular formula C17H23FN4O2 and a molecular weight of 334.40 g/mol. Its IUPAC name is N-[2-(4-fluorophenoxy)ethyl]-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide.
| Compound Name | N-[2-(4-fluorophenoxy)ethyl]-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide |
|---|---|
| PubChem CID | 95759523 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N-[2-(4-fluorophenoxy)ethyl]-2-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]acetamide |
| SMILES | C[C@H]([C@@H](C)NCC(=O)NCCOc1ccc(F)cc1)n1cccn1 |
| InChI | InChI=1S/C17H23FN4O2/c1-13(14(2)22-10-3-8-21-22)20-12-17(23)19-9-11-24-16-6-4-15(18)5-7-16/h3-8,10,13-14,20H,9,11-12H2,1-2H3,(H,19,23)/t13-,14-/m1/s1 |
| InChIKey | PBJCNKKFBPFDDS-ZIAGYGMSSA-N |
| XLogP | 1.76 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|