C21H30ClNO2 — CID 95782823
[4-(3-chlorophenyl)oxan-4-yl]-[(3S)-3-methyl-3-propylpiperidin-1-yl]methanone (PubChem CID 95782823) has the molecular formula C21H30ClNO2 and a molecular weight of 363.93 g/mol. Its IUPAC name is [4-(3-chlorophenyl)oxan-4-yl]-[(3S)-3-methyl-3-propylpiperidin-1-yl]methanone.
| Compound Name | [4-(3-chlorophenyl)oxan-4-yl]-[(3S)-3-methyl-3-propylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95782823 |
| Molecular Formula | C21H30ClNO2 |
| Molecular Weight | 363.93 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | [4-(3-chlorophenyl)oxan-4-yl]-[(3S)-3-methyl-3-propylpiperidin-1-yl]methanone |
| SMILES | CCC[C@@]1(C)CCCN(C(=O)C2(c3cccc(Cl)c3)CCOCC2)C1 |
| InChI | InChI=1S/C21H30ClNO2/c1-3-8-20(2)9-5-12-23(16-20)19(24)21(10-13-25-14-11-21)17-6-4-7-18(22)15-17/h4,6-7,15H,3,5,8-14,16H2,1-2H3/t20-/m0/s1 |
| InChIKey | QHIJDMIZPIDBIM-FQEVSTJZSA-N |
| XLogP | 4.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.93 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |