C20H22ClN3O3 — CID 95788733
3-[(3R)-1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-1-(furan-2-ylmethyl)-1-prop-2-ynylurea (PubChem CID 95788733) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is 3-[(3R)-1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-1-(furan-2-ylmethyl)-1-prop-2-ynylurea.
| Compound Name | 3-[(3R)-1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-1-(furan-2-ylmethyl)-1-prop-2-ynylurea |
|---|---|
| PubChem CID | 95788733 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 3-[(3R)-1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-1-(furan-2-ylmethyl)-1-prop-2-ynylurea |
| SMILES | C#CCN(Cc1ccco1)C(=O)N[C@@H]1CCN(c2cc(Cl)ccc2OC)C1 |
| InChI | InChI=1S/C20H22ClN3O3/c1-3-9-24(14-17-5-4-11-27-17)20(25)22-16-8-10-23(13-16)18-12-15(21)6-7-19(18)26-2/h1,4-7,11-12,16H,8-10,13-14H2,2H3,(H,22,25)/t16-/m1/s1 |
| InChIKey | IJVLJJMPLVDDHA-MRXNPFEDSA-N |
| XLogP | 3.37 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|