C24H19N5S — CID 95789496
(3S)-N,5-diphenyl-3-quinoxalin-5-yl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 95789496) has the molecular formula C24H19N5S and a molecular weight of 409.52 g/mol. Its IUPAC name is (3S)-N,5-diphenyl-3-quinoxalin-5-yl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | (3S)-N,5-diphenyl-3-quinoxalin-5-yl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 95789496 |
| Molecular Formula | C24H19N5S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | (3S)-N,5-diphenyl-3-quinoxalin-5-yl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | S=C(Nc1ccccc1)N1N=C(c2ccccc2)C[C@H]1c1cccc2nccnc12 |
| InChI | InChI=1S/C24H19N5S/c30-24(27-18-10-5-2-6-11-18)29-22(16-21(28-29)17-8-3-1-4-9-17)19-12-7-13-20-23(19)26-15-14-25-20/h1-15,22H,16H2,(H,27,30)/t22-/m0/s1 |
| InChIKey | VSJNAZFDHLMHDM-QFIPXVFZSA-N |
| XLogP | 5.18 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|