C26H23N5S — CID 95789502
(3S)-5-phenyl-N-(2-phenylethyl)-3-quinoxalin-5-yl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 95789502) has the molecular formula C26H23N5S and a molecular weight of 437.57 g/mol. Its IUPAC name is (3S)-5-phenyl-N-(2-phenylethyl)-3-quinoxalin-5-yl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | (3S)-5-phenyl-N-(2-phenylethyl)-3-quinoxalin-5-yl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 95789502 |
| Molecular Formula | C26H23N5S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (3S)-5-phenyl-N-(2-phenylethyl)-3-quinoxalin-5-yl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | S=C(NCCc1ccccc1)N1N=C(c2ccccc2)C[C@H]1c1cccc2nccnc12 |
| InChI | InChI=1S/C26H23N5S/c32-26(29-15-14-19-8-3-1-4-9-19)31-24(18-23(30-31)20-10-5-2-6-11-20)21-12-7-13-22-25(21)28-17-16-27-22/h1-13,16-17,24H,14-15,18H2,(H,29,32)/t24-/m0/s1 |
| InChIKey | LCGMHSUTYDBZBT-DEOSSOPVSA-N |
| XLogP | 4.90 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|