C27H25N5S — CID 96535904
(3S)-5-(3-methylphenyl)-N-(2-phenylethyl)-3-quinoxalin-6-yl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 96535904) has the molecular formula C27H25N5S and a molecular weight of 451.60 g/mol. Its IUPAC name is (3S)-5-(3-methylphenyl)-N-(2-phenylethyl)-3-quinoxalin-6-yl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | (3S)-5-(3-methylphenyl)-N-(2-phenylethyl)-3-quinoxalin-6-yl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 96535904 |
| Molecular Formula | C27H25N5S |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | (3S)-5-(3-methylphenyl)-N-(2-phenylethyl)-3-quinoxalin-6-yl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | Cc1cccc(C2=NN(C(=S)NCCc3ccccc3)[C@H](c3ccc4nccnc4c3)C2)c1 |
| InChI | InChI=1S/C27H25N5S/c1-19-6-5-9-21(16-19)24-18-26(22-10-11-23-25(17-22)29-15-14-28-23)32(31-24)27(33)30-13-12-20-7-3-2-4-8-20/h2-11,14-17,26H,12-13,18H2,1H3,(H,30,33)/t26-/m0/s1 |
| InChIKey | MAGCYQCTIFMMJV-SANMLTNESA-N |
| XLogP | 5.21 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|