C26H22FN5S — CID 119040869
5-(4-fluorophenyl)-N-(2-phenylethyl)-3-quinoxalin-2-yl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 119040869) has the molecular formula C26H22FN5S and a molecular weight of 455.56 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(2-phenylethyl)-3-quinoxalin-2-yl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 5-(4-fluorophenyl)-N-(2-phenylethyl)-3-quinoxalin-2-yl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 119040869 |
| Molecular Formula | C26H22FN5S |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(2-phenylethyl)-3-quinoxalin-2-yl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | Fc1ccc(C2=NN(C(=S)NCCc3ccccc3)C(c3cnc4ccccc4n3)C2)cc1 |
| InChI | InChI=1S/C26H22FN5S/c27-20-12-10-19(11-13-20)23-16-25(24-17-29-21-8-4-5-9-22(21)30-24)32(31-23)26(33)28-15-14-18-6-2-1-3-7-18/h1-13,17,25H,14-16H2,(H,28,33) |
| InChIKey | PHDQGXLXQPOZBH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|