C27H25N5OS — CID 95789485
(3R)-5-(4-methoxyphenyl)-N-(2-phenylethyl)-3-quinoxalin-5-yl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 95789485) has the molecular formula C27H25N5OS and a molecular weight of 467.60 g/mol. Its IUPAC name is (3R)-5-(4-methoxyphenyl)-N-(2-phenylethyl)-3-quinoxalin-5-yl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | (3R)-5-(4-methoxyphenyl)-N-(2-phenylethyl)-3-quinoxalin-5-yl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 95789485 |
| Molecular Formula | C27H25N5OS |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | (3R)-5-(4-methoxyphenyl)-N-(2-phenylethyl)-3-quinoxalin-5-yl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | COc1ccc(C2=NN(C(=S)NCCc3ccccc3)[C@@H](c3cccc4nccnc34)C2)cc1 |
| InChI | InChI=1S/C27H25N5OS/c1-33-21-12-10-20(11-13-21)24-18-25(22-8-5-9-23-26(22)29-17-16-28-23)32(31-24)27(34)30-15-14-19-6-3-2-4-7-19/h2-13,16-17,25H,14-15,18H2,1H3,(H,30,34)/t25-/m1/s1 |
| InChIKey | UZGJUKVCNXFBGG-RUZDIDTESA-N |
| XLogP | 4.91 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|