C17H16N6O2S — CID 95797905
2-(11,12-dimethyl-5-oxo-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-4-yl)-N-(6-methyl-2-pyridinyl)acetamide (PubChem CID 95797905) has the molecular formula C17H16N6O2S and a molecular weight of 368.42 g/mol. Its IUPAC name is 2-(11,12-dimethyl-5-oxo-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-4-yl)-N-(6-methyl-2-pyridinyl)acetamide.
| Compound Name | 2-(11,12-dimethyl-5-oxo-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-4-yl)-N-(6-methyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 95797905 |
| Molecular Formula | C17H16N6O2S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-(11,12-dimethyl-5-oxo-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraen-4-yl)-N-(6-methyl-2-pyridinyl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cn2nc3c4c(C)c(C)sc4ncn3c2=O)n1 |
| InChI | InChI=1S/C17H16N6O2S/c1-9-5-4-6-12(19-9)20-13(24)7-23-17(25)22-8-18-16-14(15(22)21-23)10(2)11(3)26-16/h4-6,8H,7H2,1-3H3,(H,19,20,24) |
| InChIKey | IWBODFPIYANTDD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |