C22H22N6O — CID 95800111
N-[4-(furan-2-yl)-5-pyrazin-2-ylpyrimidin-2-yl]-N'-methyl-N'-phenylpropane-1,3-diamine (PubChem CID 95800111) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is N-[4-(furan-2-yl)-5-pyrazin-2-ylpyrimidin-2-yl]-N'-methyl-N'-phenylpropane-1,3-diamine.
| Compound Name | N-[4-(furan-2-yl)-5-pyrazin-2-ylpyrimidin-2-yl]-N'-methyl-N'-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 95800111 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | N-[4-(furan-2-yl)-5-pyrazin-2-ylpyrimidin-2-yl]-N'-methyl-N'-phenylpropane-1,3-diamine |
| SMILES | CN(CCCNc1ncc(-c2cnccn2)c(-c2ccco2)n1)c1ccccc1 |
| InChI | InChI=1S/C22H22N6O/c1-28(17-7-3-2-4-8-17)13-6-10-25-22-26-15-18(19-16-23-11-12-24-19)21(27-22)20-9-5-14-29-20/h2-5,7-9,11-12,14-16H,6,10,13H2,1H3,(H,25,26,27) |
| InChIKey | CKLDUFZVCKNMFA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 79.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|