C19H23N3O6S — CID 95801035
3-[(3R)-1,1-dioxothiolane-3-carbonyl]-8,9-dimethoxy-1,2,4,5-tetrahydro-[1,4]diazepino[7,1-b]quinazolin-11-one (PubChem CID 95801035) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is 3-[(3R)-1,1-dioxothiolane-3-carbonyl]-8,9-dimethoxy-1,2,4,5-tetrahydro-[1,4]diazepino[7,1-b]quinazolin-11-one.
| Compound Name | 3-[(3R)-1,1-dioxothiolane-3-carbonyl]-8,9-dimethoxy-1,2,4,5-tetrahydro-[1,4]diazepino[7,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 95801035 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 3-[(3R)-1,1-dioxothiolane-3-carbonyl]-8,9-dimethoxy-1,2,4,5-tetrahydro-[1,4]diazepino[7,1-b]quinazolin-11-one |
| SMILES | COc1cc2nc3n(c(=O)c2cc1OC)CCN(C(=O)[C@H]1CCS(=O)(=O)C1)CC3 |
| InChI | InChI=1S/C19H23N3O6S/c1-27-15-9-13-14(10-16(15)28-2)20-17-3-5-21(6-7-22(17)19(13)24)18(23)12-4-8-29(25,26)11-12/h9-10,12H,3-8,11H2,1-2H3/t12-/m0/s1 |
| InChIKey | AWAMHWPBAOMMEQ-LBPRGKRZSA-N |
| XLogP | 0.23 |
| TPSA | 107.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |